{{cart_num}}
My CartCAS：1032678-07-1
Molecular Formula：C32H39ClN2O2
Molecular Weight：519.12
Storage：Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥95%
Appearance：Solid
Qty：
Size：
| CAS | 1032678-07-1 |
| Name | Cy5 Acid Chloride |
| Molecular Formula | C32H39ClN2O2 |
| Molecular Weight | 519.12 |
| Solubility | Soluble in DMSO ≥1mg/mL |
| Purity | ≥95% |
| Appearance | Solid |
| Storage | Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| MDL | MFCD28142488 |
| SMILES | CC1(C2=CC=CC=C2[N+](=C1/C=C/C=C/C=C3/C(C4=CC=CC=C4N3CCCCCC(=O)O)(C)C)C)C.[Cl-] |
| InChIKey | CC1(C2=CC=CC=C2[N+](=C1/C=C/C=C/C=C3/C(C4=CC=CC=C4N3CCCCCC(=O)O)(C)C)C)C.[Cl-] |
| InChI | InChI=1S/C32H38N2O2.ClH/c1-31(2)24-16-11-13-18-26(24)33(5)28(31)20-8-6-9-21-29- 32(3，4)25-17-12-14-19-27(25)34(29)23-15-7-10-22-30(35)36;/h6，8-9，11-14 ，16-21H，7，10，15，22-23H2，1-5H3;1H |
| PubChem CID | 137946099 |
| Background | It is a fluorescent dye containing a non-activated carboxylic acid (Ex=646 nm, Em=662 nm). |
| Unit | Bottle |
| Specification | 5mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
