{{cart_num}}
My CartCAS：150810-68-7
Molecular Formula：C29H25N3O7
Molecular Weight：527.52
Storage：Powder:2-8℃，2 years
Purity：≥98%
Appearance：Solid
Qty：
Size：
| CAS | 150810-68-7 |
| Name | 5-TAMRA-NHS ester |
| Molecular Formula | C29H25N3O7 |
| Molecular Weight | 527.52 |
| Solubility | Soluble in DMSO ≥0.1mg/mL(Need ultrasonic) |
| Purity | ≥98% |
| Appearance | Solid |
| Storage | Powder:2-8℃，2 years |
| MDL | MFCD00077324 |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=C(C=C4)C(=O)ON5C(=O)CCC5=O)C(=O)[O-] |
| InChIKey | VWFRSNKRTNUMET-UHFFFAOYSA-N |
| InChI | InChI=1S/C29H25N3O7/c1-30(2)17-6-9-20-23(14-17)38-24-15-18(31(3)4)7-10-21(24)27(20)19-8-5-16(13-22(19)28(35)36)29(37)39-32-25(33)11-12-26(32)34/h5-10，13-15H，11-12H2，1-4H3 |
| PubChem CID | 2762600 |
| Background | It is a fluorescent agent for amine reaction. Its coupling compound produces bright， pH insensitive orange fluorescence with good photostability. |
| Unit | Bottle |
| Specification | 5mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
