{{cart_num}}
My CartCAS：64091-91-4
Molecular Formula：C10H13N3O2
Molecular Weight：207.23
Storage：Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥98%
Appearance：Solid
Qty：
Size：
| CAS | 64091-91-4 |
| Name | NNK |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 |
| Solubility | Soluble in DMSO ≥5mg/mL |
| Purity | ≥98% |
| Appearance | Solid |
| Storage | Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| EC | EINECS 636-341-2 |
| MDL | MFCD00274580 |
| SMILES | CN(CCCC(=O)C1=CN=CC=C1)N=O |
| InChIKey | FLAQQSHRLBFIEZ-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H13N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2，4，6，8H，3，5，7H2，1H3 |
| PubChem CID | 47289 |
| Target Point | Others |
| Passage | Others |
| Background | NNK is a nitrosation derivative of nicotine that activates ERK1/2 and PKCα， and activates Bcl2 phosphorylation at Ser70 and c-Myc at Thr58 and Ser62. NNK can be used to construct mouse models of lung cancer and induce the proliferation and survival of human lung cancer cells. |
| Unit | Bottle |
| Specification | 1mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
