{{cart_num}}
My CartCAS：83668-91-1
Molecular Formula：C29H40N2O3S
Molecular Weight：496.7
Storage：Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥98%
Appearance：Soild
Qty：
Size：
| CAS | 83668-91-1 |
| Name | RH 237 |
| Molecular Formula | C29H40N2O3S |
| Molecular Weight | 496.7 |
| Solubility | Soluble in DMSO |
| Purity | ≥98% |
| Appearance | Soild |
| Storage | Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| SMILES | CCCCN(CCCC)C1=CC=C(C=C1)C=CC=CC=CC2=CC=[N+](C=C2)CCCCS(=O)(=O)[O-] |
| InChIKey | VJFBYTPFDXZYDN-UHFFFAOYSA-N |
| InChI | InChI=1S/C29H40N2O3S/c1-3-5-22-31(23-6-4-2)29-17-15-27(16-18-29)13-9-7-8-10-14-28-19-24-30(25-20-28)21-11-12-26-35(32，33)34/h7-10，13-20，24-25H，3-6，11-12，21-23，26H2，1-2H3 |
| PubChem CID | 6439667 |
| Background | RH237 is a rapid response potential probe used primarily for functional imaging of neurons， but also for monitoring cell membrane potential， synaptic activity and neuronal ion channel activity. Ex/Em=528/782 nm. |
| Unit | Bottle |
| Specification | 5mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no experimental images.
Sorry, there is no more information.
Manual Download
