{{cart_num}}
My CartCAS：157134-53-7
Molecular Formula：C36H52N2O3S
Molecular Weight：592.87
Storage：Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥98%
Appearance：Brown to red Soild
Qty：
Size：
| CAS | 157134-53-7 |
| Name | Di-8-ANEPPS |
| Molecular Formula | C36H52N2O3S |
| Molecular Weight | 592.87 |
| Solubility | Soluble in DMSO(Need ultrasonic) |
| Purity | ≥98% |
| Appearance | Brown to red Soild |
| Storage | Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| MDL | MFCD03453608 |
| SMILES | CCCCCCCCN(CCCCCCCC)C1=CC2=C(C=C1)C=C(C=C2)C=CC3=CC=[N+](C=C3)CCCS(=O)(=O)[O-] |
| InChIKey | IXFSUSNUALIXLU-UHFFFOYSA-N |
| InChI | InChI=1S/C36H52N2O3S/c1-3-5-7-9-11-13-25-38(26-14-12-10-8-6-4-2)36-21-20-34-30- 33(18-19-35(34)31-36)17-16-32-22-27-37(28-23-32)24-15-29-42(39，40)41/h16-23， 27-28，30-31H，3-15，24-26，29H2，1-2H3 |
| PubChem CID | 6508718 |
| Background | Di-8-ANEPES is a class of dyes that can quickly react to changes in membrane potential. Their optical reaction can quickly detect changes in instantaneous transmembrane potential in cells， and can be used to measure rapid changes in membrane potential. |
| Unit | Bottle |
| Specification | 5mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
